C22H19ClN4O2 — CID 46047120
3-(2-chlorophenyl)-7-[(3-methylphenyl)methyl]-1-prop-2-enylpurine-2,6-dione (PubChem CID 46047120) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-7-[(3-methylphenyl)methyl]-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-(2-chlorophenyl)-7-[(3-methylphenyl)methyl]-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 46047120 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-(2-chlorophenyl)-7-[(3-methylphenyl)methyl]-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2cccc(C)c2)n(-c2ccccc2Cl)c1=O |
| InChI | InChI=1S/C22H19ClN4O2/c1-3-11-26-21(28)19-20(27(22(26)29)18-10-5-4-9-17(18)23)24-14-25(19)13-16-8-6-7-15(2)12-16/h3-10,12,14H,1,11,13H2,2H3 |
| InChIKey | XMJUPGMIRVPWSB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|