C27H24N4O2 — CID 46060792
1-benzyl-3-(2-methylphenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione (PubChem CID 46060792) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-benzyl-3-(2-methylphenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 1-benzyl-3-(2-methylphenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46060792 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-benzyl-3-(2-methylphenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione |
| SMILES | Cc1cccc(Cn2cnc3c2c(=O)n(Cc2ccccc2)c(=O)n3-c2ccccc2C)c1 |
| InChI | InChI=1S/C27H24N4O2/c1-19-9-8-13-22(15-19)16-29-18-28-25-24(29)26(32)30(17-21-11-4-3-5-12-21)27(33)31(25)23-14-7-6-10-20(23)2/h3-15,18H,16-17H2,1-2H3 |
| InChIKey | HHRRPKMSTMUGOP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |