C21H19ClN4O2 — CID 46158861
3-(2-chlorophenyl)-1-ethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione (PubChem CID 46158861) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-ethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 3-(2-chlorophenyl)-1-ethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46158861 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-(2-chlorophenyl)-1-ethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2cccc(C)c2)n(-c2ccccc2Cl)c1=O |
| InChI | InChI=1S/C21H19ClN4O2/c1-3-25-20(27)18-19(26(21(25)28)17-10-5-4-9-16(17)22)23-13-24(18)12-15-8-6-7-14(2)11-15/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | QGJPRIVFTSTVRN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |