C22H22N4O2 — CID 42853207
1-ethyl-3-(2-methylphenyl)-7-[(4-methylphenyl)methyl]purine-2,6-dione (PubChem CID 42853207) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylphenyl)-7-[(4-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 1-ethyl-3-(2-methylphenyl)-7-[(4-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 42853207 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-ethyl-3-(2-methylphenyl)-7-[(4-methylphenyl)methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccc(C)cc2)n(-c2ccccc2C)c1=O |
| InChI | InChI=1S/C22H22N4O2/c1-4-25-21(27)19-20(26(22(25)28)18-8-6-5-7-16(18)3)23-14-24(19)13-17-11-9-15(2)10-12-17/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | HFQFAWJGXSDMEV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |