C22H18Cl2N4O2 — CID 83289316
7-[(3,4-dichlorophenyl)methyl]-3-(2-methylphenyl)-1-prop-2-enylpurine-2,6-dione (PubChem CID 83289316) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methyl]-3-(2-methylphenyl)-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 7-[(3,4-dichlorophenyl)methyl]-3-(2-methylphenyl)-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 83289316 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methyl]-3-(2-methylphenyl)-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2ccc(Cl)c(Cl)c2)n(-c2ccccc2C)c1=O |
| InChI | InChI=1S/C22H18Cl2N4O2/c1-3-10-27-21(29)19-20(28(22(27)30)18-7-5-4-6-14(18)2)25-13-26(19)12-15-8-9-16(23)17(24)11-15/h3-9,11,13H,1,10,12H2,2H3 |
| InChIKey | YIJYGXIFTOFVIZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|