C23H22N4O3 — CID 11235036
3-benzyl-7-[(4-methoxyphenyl)methyl]-1-prop-2-enylpurine-2,6-dione (PubChem CID 11235036) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-benzyl-7-[(4-methoxyphenyl)methyl]-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-benzyl-7-[(4-methoxyphenyl)methyl]-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 11235036 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-benzyl-7-[(4-methoxyphenyl)methyl]-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2ccc(OC)cc2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H22N4O3/c1-3-13-26-22(28)20-21(27(23(26)29)15-17-7-5-4-6-8-17)24-16-25(20)14-18-9-11-19(30-2)12-10-18/h3-12,16H,1,13-15H2,2H3 |
| InChIKey | YNVHFCQGYHJWEW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|