C25H28N4O4 — CID 3923214
3-benzyl-1-[2-(4-methoxyphenoxy)ethyl]-7-(2-methylpropyl)purine-2,6-dione (PubChem CID 3923214) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-benzyl-1-[2-(4-methoxyphenoxy)ethyl]-7-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 3-benzyl-1-[2-(4-methoxyphenoxy)ethyl]-7-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3923214 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-benzyl-1-[2-(4-methoxyphenoxy)ethyl]-7-(2-methylpropyl)purine-2,6-dione |
| SMILES | COc1ccc(OCCn2c(=O)c3c(ncn3CC(C)C)n(Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C25H28N4O4/c1-18(2)15-27-17-26-23-22(27)24(30)28(13-14-33-21-11-9-20(32-3)10-12-21)25(31)29(23)16-19-7-5-4-6-8-19/h4-12,17-18H,13-16H2,1-3H3 |
| InChIKey | FVWMTPQUBZCSOC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |