C23H23ClN4O3 — CID 42863312
3-(2-chlorophenyl)-1-(2-methylpropyl)-7-(2-phenoxyethyl)purine-2,6-dione (PubChem CID 42863312) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(2-methylpropyl)-7-(2-phenoxyethyl)purine-2,6-dione.
| Compound Name | 3-(2-chlorophenyl)-1-(2-methylpropyl)-7-(2-phenoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 42863312 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(2-methylpropyl)-7-(2-phenoxyethyl)purine-2,6-dione |
| SMILES | CC(C)Cn1c(=O)c2c(ncn2CCOc2ccccc2)n(-c2ccccc2Cl)c1=O |
| InChI | InChI=1S/C23H23ClN4O3/c1-16(2)14-27-22(29)20-21(28(23(27)30)19-11-7-6-10-18(19)24)25-15-26(20)12-13-31-17-8-4-3-5-9-17/h3-11,15-16H,12-14H2,1-2H3 |
| InChIKey | UULTWPJFPPXBMW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |