C23H22ClN5O4 — CID 42863033
3-(2-chlorophenyl)-1-(3-methylbutyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 42863033) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(3-methylbutyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione.
| Compound Name | 3-(2-chlorophenyl)-1-(3-methylbutyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 42863033 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(3-methylbutyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | CC(C)CCn1c(=O)c2c(ncn2Cc2ccc([N+](=O)[O-])cc2)n(-c2ccccc2Cl)c1=O |
| InChI | InChI=1S/C23H22ClN5O4/c1-15(2)11-12-27-22(30)20-21(28(23(27)31)19-6-4-3-5-18(19)24)25-14-26(20)13-16-7-9-17(10-8-16)29(32)33/h3-10,14-15H,11-13H2,1-2H3 |
| InChIKey | UDKGSHWTGWZQJP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|