C20H17KN4O3 — CID 11338548
potassium 1-benzyl-7-[(4-methoxyphenyl)methyl]purin-3-ide-2,6-dione (PubChem CID 11338548) has the molecular formula C20H17KN4O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is potassium 1-benzyl-7-[(4-methoxyphenyl)methyl]purin-3-ide-2,6-dione.
| Compound Name | potassium 1-benzyl-7-[(4-methoxyphenyl)methyl]purin-3-ide-2,6-dione |
|---|---|
| PubChem CID | 11338548 |
| Molecular Formula | C20H17KN4O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | potassium 1-benzyl-7-[(4-methoxyphenyl)methyl]purin-3-ide-2,6-dione |
| SMILES | COc1ccc(Cn2cnc3[n-]c(=O)n(Cc4ccccc4)c(=O)c32)cc1.[K+] |
| InChI | InChI=1S/C20H18N4O3.K/c1-27-16-9-7-15(8-10-16)11-23-13-21-18-17(23)19(25)24(20(26)22-18)12-14-5-3-2-4-6-14;/h2-10,13H,11-12H2,1H3,(H,22,25,26);/q;+1/p-1 |
| InChIKey | WPUHMQRBJSTNET-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 80.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |