C13H14ClN6O2P — CID 170722671
6-amino-9-[(6-chloro-3-pyridinyl)methyl]-2-dimethylphosphoryl-7H-purin-8-one (PubChem CID 170722671) has the molecular formula C13H14ClN6O2P and a molecular weight of 352.72 g/mol. Its IUPAC name is 6-amino-9-[(6-chloro-3-pyridinyl)methyl]-2-dimethylphosphoryl-7H-purin-8-one.
| Compound Name | 6-amino-9-[(6-chloro-3-pyridinyl)methyl]-2-dimethylphosphoryl-7H-purin-8-one |
|---|---|
| PubChem CID | 170722671 |
| Molecular Formula | C13H14ClN6O2P |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 6-amino-9-[(6-chloro-3-pyridinyl)methyl]-2-dimethylphosphoryl-7H-purin-8-one |
| SMILES | CP(C)(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccc(Cl)nc3)c2n1 |
| InChI | InChI=1S/C13H14ClN6O2P/c1-23(2,22)12-18-10(15)9-11(19-12)20(13(21)17-9)6-7-3-4-8(14)16-5-7/h3-5H,6H2,1-2H3,(H,17,21)(H2,15,18,19) |
| InChIKey | XGUQFGKIMVTXHB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|