C38H46N6O4 — CID 157021982
[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanol (PubChem CID 157021982) has the molecular formula C38H46N6O4 and a molecular weight of 650.82 g/mol. Its IUPAC name is [4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanol.
| Compound Name | [4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanol |
|---|---|
| PubChem CID | 157021982 |
| Molecular Formula | C38H46N6O4 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | [4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanol |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)c3ccc(CN4CCCCC4)cc3)n2n1 |
| InChI | InChI=1S/C38H46N6O4/c1-4-5-23-48-38-40-37(43(26-29-11-17-32(46-2)18-12-29)27-30-13-19-33(47-3)20-14-30)36-39-24-34(44(36)41-38)35(45)31-15-9-28(10-16-31)25-42-21-7-6-8-22-42/h9-20,24,35,45H,4-8,21-23,25-27H2,1-3H3 |
| InChIKey | DVEIXPMNUGWSTI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|