C40H50N6O7 — CID 157021967
tert-butyl N-[3-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]phenoxy]propyl]carbamate (PubChem CID 157021967) has the molecular formula C40H50N6O7 and a molecular weight of 726.87 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 157021967 |
| Molecular Formula | C40H50N6O7 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | tert-butyl N-[3-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]phenoxy]propyl]carbamate |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)c3ccc(OCCCNC(=O)OC(C)(C)C)cc3)n2n1 |
| InChI | InChI=1S/C40H50N6O7/c1-7-8-23-52-38-43-37(45(26-28-10-16-31(49-5)17-11-28)27-29-12-18-32(50-6)19-13-29)36-42-25-34(46(36)44-38)35(47)30-14-20-33(21-15-30)51-24-9-22-41-39(48)53-40(2,3)4/h10-21,25,35,47H,7-9,22-24,26-27H2,1-6H3,(H,41,48) |
| InChIKey | LNQLHNMNXAIVPO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|