C43H54N6O6 — CID 157021832
tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-methylphenyl]piperidine-1-carboxylate (PubChem CID 157021832) has the molecular formula C43H54N6O6 and a molecular weight of 750.94 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-methylphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-methylphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 157021832 |
| Molecular Formula | C43H54N6O6 |
| Molecular Weight | 750.94 g/mol |
| Exact Mass | 750.41 |
| IUPAC Name | tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-methylphenyl]piperidine-1-carboxylate |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)c3ccc(C4CCN(C(=O)OC(C)(C)C)CC4)c(C)c3)n2n1 |
| InChI | InChI=1S/C43H54N6O6/c1-8-9-24-54-41-45-40(48(27-30-10-15-34(52-6)16-11-30)28-31-12-17-35(53-7)18-13-31)39-44-26-37(49(39)46-41)38(50)33-14-19-36(29(2)25-33)32-20-22-47(23-21-32)42(51)55-43(3,4)5/h10-19,25-26,32,38,50H,8-9,20-24,27-28H2,1-7H3 |
| InChIKey | JTKAVKOEUVCZIK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.94 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|