C36H41ClN8O6 — CID 175606904
4-[5-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3-chloro-2-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 175606904) has the molecular formula C36H41ClN8O6 and a molecular weight of 717.23 g/mol. Its IUPAC name is 4-[5-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3-chloro-2-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3-chloro-2-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175606904 |
| Molecular Formula | C36H41ClN8O6 |
| Molecular Weight | 717.23 g/mol |
| Exact Mass | 716.28 |
| IUPAC Name | 4-[5-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3-chloro-2-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)c3cnc(N4CCN(C(=O)O)CC4)c(Cl)c3)n2n1 |
| InChI | InChI=1S/C36H41ClN8O6/c1-4-5-18-51-35-40-34(44(22-24-6-10-27(49-2)11-7-24)23-25-8-12-28(50-3)13-9-25)33-39-21-30(45(33)41-35)31(46)26-19-29(37)32(38-20-26)42-14-16-43(17-15-42)36(47)48/h6-13,19-21,31,46H,4-5,14-18,22-23H2,1-3H3,(H,47,48) |
| InChIKey | PUEVFDPJJJDYLM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.23 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|