C25H28BrN5O3 — CID 155777682
7-bromo-2-butoxy-N,N-bis[(4-methoxyphenyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155777682) has the molecular formula C25H28BrN5O3 and a molecular weight of 526.44 g/mol. Its IUPAC name is 7-bromo-2-butoxy-N,N-bis[(4-methoxyphenyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-bromo-2-butoxy-N,N-bis[(4-methoxyphenyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155777682 |
| Molecular Formula | C25H28BrN5O3 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 7-bromo-2-butoxy-N,N-bis[(4-methoxyphenyl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(Br)n2n1 |
| InChI | InChI=1S/C25H28BrN5O3/c1-4-5-14-34-25-28-24(23-27-15-22(26)31(23)29-25)30(16-18-6-10-20(32-2)11-7-18)17-19-8-12-21(33-3)13-9-19/h6-13,15H,4-5,14,16-17H2,1-3H3 |
| InChIKey | LJNDUGIVXYNVJL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|