C38H49N7O5 — CID 157021865
[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[6-[3-(dimethylamino)-2,2-dimethylpropoxy]-3-pyridinyl]methanol (PubChem CID 157021865) has the molecular formula C38H49N7O5 and a molecular weight of 683.85 g/mol. Its IUPAC name is [4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[6-[3-(dimethylamino)-2,2-dimethylpropoxy]-3-pyridinyl]methanol.
| Compound Name | [4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[6-[3-(dimethylamino)-2,2-dimethylpropoxy]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 157021865 |
| Molecular Formula | C38H49N7O5 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.38 |
| IUPAC Name | [4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-[6-[3-(dimethylamino)-2,2-dimethylpropoxy]-3-pyridinyl]methanol |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)c3ccc(OCC(C)(C)CN(C)C)nc3)n2n1 |
| InChI | InChI=1S/C38H49N7O5/c1-8-9-20-49-37-41-36(44(23-27-10-15-30(47-6)16-11-27)24-28-12-17-31(48-7)18-13-28)35-40-22-32(45(35)42-37)34(46)29-14-19-33(39-21-29)50-26-38(2,3)25-43(4)5/h10-19,21-22,34,46H,8-9,20,23-26H2,1-7H3 |
| InChIKey | BMBNGUHQIIRSNZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|