C44H57N7O6 — CID 157021755
tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-propan-2-ylphenyl]piperazine-1-carboxylate (PubChem CID 157021755) has the molecular formula C44H57N7O6 and a molecular weight of 779.98 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-propan-2-ylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-propan-2-ylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 157021755 |
| Molecular Formula | C44H57N7O6 |
| Molecular Weight | 779.98 g/mol |
| Exact Mass | 779.44 |
| IUPAC Name | tert-butyl 4-[4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-butoxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-2-propan-2-ylphenyl]piperazine-1-carboxylate |
| SMILES | CCCCOc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)c3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)c(C(C)C)c3)n2n1 |
| InChI | InChI=1S/C44H57N7O6/c1-9-10-25-56-42-46-41(50(28-31-11-16-34(54-7)17-12-31)29-32-13-18-35(55-8)19-14-32)40-45-27-38(51(40)47-42)39(52)33-15-20-37(36(26-33)30(2)3)48-21-23-49(24-22-48)43(53)57-44(4,5)6/h11-20,26-27,30,39,52H,9-10,21-25,28-29H2,1-8H3 |
| InChIKey | GJMNFLFZIWWUSY-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.98 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|