C26H38N6O6 — CID 143428599
methyl 2-[3-[2-[4-[[[6-amino-2-(2-methoxyethoxy)-5-(methylamino)pyrimidin-4-yl]-formylamino]methyl]piperidin-1-yl]ethoxy]phenyl]acetate (PubChem CID 143428599) has the molecular formula C26H38N6O6 and a molecular weight of 530.63 g/mol. Its IUPAC name is methyl 2-[3-[2-[4-[[[6-amino-2-(2-methoxyethoxy)-5-(methylamino)pyrimidin-4-yl]-formylamino]methyl]piperidin-1-yl]ethoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[2-[4-[[[6-amino-2-(2-methoxyethoxy)-5-(methylamino)pyrimidin-4-yl]-formylamino]methyl]piperidin-1-yl]ethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 143428599 |
| Molecular Formula | C26H38N6O6 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | methyl 2-[3-[2-[4-[[[6-amino-2-(2-methoxyethoxy)-5-(methylamino)pyrimidin-4-yl]-formylamino]methyl]piperidin-1-yl]ethoxy]phenyl]acetate |
| SMILES | CNc1c(N)nc(OCCOC)nc1N(C=O)CC1CCN(CCOc2cccc(CC(=O)OC)c2)CC1 |
| InChI | InChI=1S/C26H38N6O6/c1-28-23-24(27)29-26(38-14-13-35-2)30-25(23)32(18-33)17-19-7-9-31(10-8-19)11-12-37-21-6-4-5-20(15-21)16-22(34)36-3/h4-6,15,18-19,28H,7-14,16-17H2,1-3H3,(H2,27,29,30) |
| InChIKey | YIYXOTOUHNEVST-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|