C24H40N8O — CID 145477306
2-butoxy-4-N-[7-(4-pyridin-4-ylpiperazin-1-yl)heptyl]pyrimidine-4,5,6-triamine (PubChem CID 145477306) has the molecular formula C24H40N8O and a molecular weight of 456.64 g/mol. Its IUPAC name is 2-butoxy-4-N-[7-(4-pyridin-4-ylpiperazin-1-yl)heptyl]pyrimidine-4,5,6-triamine.
| Compound Name | 2-butoxy-4-N-[7-(4-pyridin-4-ylpiperazin-1-yl)heptyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 145477306 |
| Molecular Formula | C24H40N8O |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | 2-butoxy-4-N-[7-(4-pyridin-4-ylpiperazin-1-yl)heptyl]pyrimidine-4,5,6-triamine |
| SMILES | CCCCOc1nc(N)c(N)c(NCCCCCCCN2CCN(c3ccncc3)CC2)n1 |
| InChI | InChI=1S/C24H40N8O/c1-2-3-19-33-24-29-22(26)21(25)23(30-24)28-11-7-5-4-6-8-14-31-15-17-32(18-16-31)20-9-12-27-13-10-20/h9-10,12-13H,2-8,11,14-19,25H2,1H3,(H3,26,28,29,30) |
| InChIKey | SQXJOFHCNGVQDS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|