C23H40N6O2 — CID 58290981
4-amino-2-butoxy-7-[5-(4-tert-butylpiperazin-1-yl)pentyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58290981) has the molecular formula C23H40N6O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[5-(4-tert-butylpiperazin-1-yl)pentyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[5-(4-tert-butylpiperazin-1-yl)pentyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58290981 |
| Molecular Formula | C23H40N6O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 4-amino-2-butoxy-7-[5-(4-tert-butylpiperazin-1-yl)pentyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(CCCCCN1CCN(C(C)(C)C)CC1)C(=O)C2 |
| InChI | InChI=1S/C23H40N6O2/c1-5-6-16-31-22-25-20(24)18-17-19(30)29(21(18)26-22)11-9-7-8-10-27-12-14-28(15-13-27)23(2,3)4/h5-17H2,1-4H3,(H2,24,25,26) |
| InChIKey | NWMXVMRODINZCN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|