C25H41N5O2 — CID 58306250
4-amino-2-butoxy-7-[4-(1-cyclohexylpiperidin-4-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58306250) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[4-(1-cyclohexylpiperidin-4-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[4-(1-cyclohexylpiperidin-4-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58306250 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | 4-amino-2-butoxy-7-[4-(1-cyclohexylpiperidin-4-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(CCCCC1CCN(C3CCCCC3)CC1)C(=O)C2 |
| InChI | InChI=1S/C25H41N5O2/c1-2-3-17-32-25-27-23(26)21-18-22(31)30(24(21)28-25)14-8-7-9-19-12-15-29(16-13-19)20-10-5-4-6-11-20/h19-20H,2-18H2,1H3,(H2,26,27,28) |
| InChIKey | WXTDIGQHWAXZSP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|