C19H30N4O3 — CID 163443981
4-amino-2-butoxy-8-[3-(oxan-3-yl)propyl]-5,6-dihydropyrido[2,3-d]pyrimidin-7-one (PubChem CID 163443981) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-[3-(oxan-3-yl)propyl]-5,6-dihydropyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-amino-2-butoxy-8-[3-(oxan-3-yl)propyl]-5,6-dihydropyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 163443981 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 4-amino-2-butoxy-8-[3-(oxan-3-yl)propyl]-5,6-dihydropyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(CCCC1CCCOC1)C(=O)CC2 |
| InChI | InChI=1S/C19H30N4O3/c1-2-3-12-26-19-21-17(20)15-8-9-16(24)23(18(15)22-19)10-4-6-14-7-5-11-25-13-14/h14H,2-13H2,1H3,(H2,20,21,22) |
| InChIKey | BAYBJJJACTUOBN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|