C20H25N6O4- — CID 23158561
2-[3-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethylamino]phenyl]acetate (PubChem CID 23158561) has the molecular formula C20H25N6O4- and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[3-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethylamino]phenyl]acetate.
| Compound Name | 2-[3-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethylamino]phenyl]acetate |
|---|---|
| PubChem CID | 23158561 |
| Molecular Formula | C20H25N6O4- |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-[3-[2-(6-amino-2-butoxy-8-methoxypurin-9-yl)ethylamino]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(CCNc3cccc(CC(=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C20H26N6O4/c1-3-4-10-30-19-24-17(21)16-18(25-19)26(20(23-16)29-2)9-8-22-14-7-5-6-13(11-14)12-15(27)28/h5-7,11,22H,3-4,8-10,12H2,1-2H3,(H,27,28)(H2,21,24,25)/p-1 |
| InChIKey | REXTVOBLUULRFC-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|