C28H39N5O4 — CID 123165366
benzyl 3-[4-(2-butoxy-8-methoxy-6-methylpurin-9-yl)butyl]piperidine-1-carboxylate (PubChem CID 123165366) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is benzyl 3-[4-(2-butoxy-8-methoxy-6-methylpurin-9-yl)butyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[4-(2-butoxy-8-methoxy-6-methylpurin-9-yl)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123165366 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | benzyl 3-[4-(2-butoxy-8-methoxy-6-methylpurin-9-yl)butyl]piperidine-1-carboxylate |
| SMILES | CCCCOc1nc(C)c2nc(OC)n(CCCCC3CCCN(C(=O)OCc4ccccc4)C3)c2n1 |
| InChI | InChI=1S/C28H39N5O4/c1-4-5-18-36-26-29-21(2)24-25(31-26)33(27(30-24)35-3)17-10-9-12-22-15-11-16-32(19-22)28(34)37-20-23-13-7-6-8-14-23/h6-8,13-14,22H,4-5,9-12,15-20H2,1-3H3 |
| InChIKey | VCJGSXLFAATKMX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|