C23H32N6O5 — CID 91052886
[3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl] propanoate (PubChem CID 91052886) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is [3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl] propanoate.
| Compound Name | [3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 91052886 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [3-[[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl-(2-hydroxyethyl)amino]methyl]phenyl] propanoate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCN(CCO)Cc3cccc(OC(=O)CC)c3)c2n1 |
| InChI | InChI=1S/C23H32N6O5/c1-3-5-13-33-22-26-20(24)19-21(27-22)29(23(32)25-19)10-9-28(11-12-30)15-16-7-6-8-17(14-16)34-18(31)4-2/h6-8,14,30H,3-5,9-13,15H2,1-2H3,(H,25,32)(H2,24,26,27) |
| InChIKey | AQFLALFPQFWBOO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|