C28H42N7O6S- — CID 23158516
2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(dimethylamino)-2,2-dimethylpropyl]sulfamoyl]phenyl]acetate (PubChem CID 23158516) has the molecular formula C28H42N7O6S- and a molecular weight of 604.75 g/mol. Its IUPAC name is 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(dimethylamino)-2,2-dimethylpropyl]sulfamoyl]phenyl]acetate.
| Compound Name | 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(dimethylamino)-2,2-dimethylpropyl]sulfamoyl]phenyl]acetate |
|---|---|
| PubChem CID | 23158516 |
| Molecular Formula | C28H42N7O6S- |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 2-[3-[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(dimethylamino)-2,2-dimethylpropyl]sulfamoyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCN(CC(C)(C)CN(C)C)S(=O)(=O)c3cccc(CC(=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C28H43N7O6S/c1-6-7-15-41-26-31-24(29)23-25(32-26)35(27(38)30-23)14-9-8-13-34(19-28(2,3)18-33(4)5)42(39,40)21-12-10-11-20(16-21)17-22(36)37/h10-12,16H,6-9,13-15,17-19H2,1-5H3,(H,30,38)(H,36,37)(H2,29,31,32)/p-1 |
| InChIKey | PKWUJCQCMCISIK-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|