C23H33N7O5 — CID 176767198
ethyl N-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methylamino]butyl]carbamate (PubChem CID 176767198) has the molecular formula C23H33N7O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is ethyl N-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methylamino]butyl]carbamate.
| Compound Name | ethyl N-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 176767198 |
| Molecular Formula | C23H33N7O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | ethyl N-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methylamino]butyl]carbamate |
| SMILES | CCOC(=O)NCCCCNCc1ccc(Cn2c(=O)[nH]c3c(N)nc(OCC)nc32)c(OC)c1 |
| InChI | InChI=1S/C23H33N7O5/c1-4-34-21-28-19(24)18-20(29-21)30(22(31)27-18)14-16-9-8-15(12-17(16)33-3)13-25-10-6-7-11-26-23(32)35-5-2/h8-9,12,25H,4-7,10-11,13-14H2,1-3H3,(H,26,32)(H,27,31)(H2,24,28,29) |
| InChIKey | SZTVTZZGBHLSRI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|