C29H41N9O8S — CID 170741809
2-[(2S)-2-amino-2-carboxyethyl]sulfanyl-4-[2-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethylamino]-4-oxobutanoic acid (PubChem CID 170741809) has the molecular formula C29H41N9O8S and a molecular weight of 675.77 g/mol. Its IUPAC name is 2-[(2S)-2-amino-2-carboxyethyl]sulfanyl-4-[2-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 2-[(2S)-2-amino-2-carboxyethyl]sulfanyl-4-[2-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170741809 |
| Molecular Formula | C29H41N9O8S |
| Molecular Weight | 675.77 g/mol |
| Exact Mass | 675.28 |
| IUPAC Name | 2-[(2S)-2-amino-2-carboxyethyl]sulfanyl-4-[2-[4-[[4-[(6-amino-2-ethoxy-8-oxo-7H-purin-9-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethylamino]-4-oxobutanoic acid |
| SMILES | CCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCN(CCNC(=O)CC(SC[C@@H](N)C(=O)O)C(=O)O)CC4)cc3OC)c2n1 |
| InChI | InChI=1S/C29H41N9O8S/c1-3-46-28-34-24(31)23-25(35-28)38(29(44)33-23)15-18-5-4-17(12-20(18)45-2)14-37-10-8-36(9-11-37)7-6-32-22(39)13-21(27(42)43)47-16-19(30)26(40)41/h4-5,12,19,21H,3,6-11,13-16,30H2,1-2H3,(H,32,39)(H,33,44)(H,40,41)(H,42,43)(H2,31,34,35)/t19-,21?/m1/s1 |
| InChIKey | WLFNGQOJUKUTSI-YMBRHYMPSA-N |
| XLogP | -0.62 |
| TPSA | 244.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.77 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |