C20H29N7O3 — CID 170741740
6-amino-9-[[4-[(4-aminobutylamino)methyl]-2-methoxyphenyl]methyl]-2-ethoxy-7H-purin-8-one (PubChem CID 170741740) has the molecular formula C20H29N7O3 and a molecular weight of 415.50 g/mol. Its IUPAC name is 6-amino-9-[[4-[(4-aminobutylamino)methyl]-2-methoxyphenyl]methyl]-2-ethoxy-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[(4-aminobutylamino)methyl]-2-methoxyphenyl]methyl]-2-ethoxy-7H-purin-8-one |
|---|---|
| PubChem CID | 170741740 |
| Molecular Formula | C20H29N7O3 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 6-amino-9-[[4-[(4-aminobutylamino)methyl]-2-methoxyphenyl]methyl]-2-ethoxy-7H-purin-8-one |
| SMILES | CCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNCCCCN)cc3OC)c2n1 |
| InChI | InChI=1S/C20H29N7O3/c1-3-30-19-25-17(22)16-18(26-19)27(20(28)24-16)12-14-7-6-13(10-15(14)29-2)11-23-9-5-4-8-21/h6-7,10,23H,3-5,8-9,11-12,21H2,1-2H3,(H,24,28)(H2,22,25,26) |
| InChIKey | ZAEJYDNSOLXGBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|