C18H26N8O2 — CID 156596134
6-amino-2-butoxy-9-[[5-[(propan-2-ylamino)methyl]pyrazin-2-yl]methyl]-7H-purin-8-one (PubChem CID 156596134) has the molecular formula C18H26N8O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[5-[(propan-2-ylamino)methyl]pyrazin-2-yl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[5-[(propan-2-ylamino)methyl]pyrazin-2-yl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 156596134 |
| Molecular Formula | C18H26N8O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 6-amino-2-butoxy-9-[[5-[(propan-2-ylamino)methyl]pyrazin-2-yl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cnc(CNC(C)C)cn3)c2n1 |
| InChI | InChI=1S/C18H26N8O2/c1-4-5-6-28-17-24-15(19)14-16(25-17)26(18(27)23-14)10-13-9-21-12(8-22-13)7-20-11(2)3/h8-9,11,20H,4-7,10H2,1-3H3,(H,23,27)(H2,19,24,25) |
| InChIKey | HUADOJWYMLAEOK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|