C27H33N7O2S — CID 154584491
6-amino-2-butoxy-9-[[10-methyl-7-[(propan-2-ylamino)methyl]phenothiazin-3-yl]methyl]-7H-purin-8-one (PubChem CID 154584491) has the molecular formula C27H33N7O2S and a molecular weight of 519.68 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[10-methyl-7-[(propan-2-ylamino)methyl]phenothiazin-3-yl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[10-methyl-7-[(propan-2-ylamino)methyl]phenothiazin-3-yl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154584491 |
| Molecular Formula | C27H33N7O2S |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 6-amino-2-butoxy-9-[[10-methyl-7-[(propan-2-ylamino)methyl]phenothiazin-3-yl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc4c(c3)Sc3cc(CNC(C)C)ccc3N4C)c2n1 |
| InChI | InChI=1S/C27H33N7O2S/c1-5-6-11-36-26-31-24(28)23-25(32-26)34(27(35)30-23)15-18-8-10-20-22(13-18)37-21-12-17(14-29-16(2)3)7-9-19(21)33(20)4/h7-10,12-13,16,29H,5-6,11,14-15H2,1-4H3,(H,30,35)(H2,28,31,32) |
| InChIKey | VZAPQEUJSMDGBZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|