C20H32N6O4 — CID 162188432
7-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-N-tert-butyl-4-oxoheptanamide (PubChem CID 162188432) has the molecular formula C20H32N6O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 7-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-N-tert-butyl-4-oxoheptanamide.
| Compound Name | 7-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-N-tert-butyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 162188432 |
| Molecular Formula | C20H32N6O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 7-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)-N-tert-butyl-4-oxoheptanamide |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCC(=O)CCC(=O)NC(C)(C)C)c2n1 |
| InChI | InChI=1S/C20H32N6O4/c1-5-6-12-30-18-23-16(21)15-17(24-18)26(19(29)22-15)11-7-8-13(27)9-10-14(28)25-20(2,3)4/h5-12H2,1-4H3,(H,22,29)(H,25,28)(H2,21,23,24) |
| InChIKey | ZPYWSTSHQMHDIH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|