C8H13N5O6P+ — CID 123198290
[2-[(6-amino-7H-purin-9-ium-2-yl)oxy]-1-hydroxyethoxy]methylphosphonic acid (PubChem CID 123198290) has the molecular formula C8H13N5O6P+ and a molecular weight of 306.20 g/mol. Its IUPAC name is [2-[(6-amino-7H-purin-9-ium-2-yl)oxy]-1-hydroxyethoxy]methylphosphonic acid.
| Compound Name | [2-[(6-amino-7H-purin-9-ium-2-yl)oxy]-1-hydroxyethoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 123198290 |
| Molecular Formula | C8H13N5O6P+ |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | [2-[(6-amino-7H-purin-9-ium-2-yl)oxy]-1-hydroxyethoxy]methylphosphonic acid |
| SMILES | Nc1nc(OCC(O)OCP(=O)(O)O)nc2[nH+]c[nH]c12 |
| InChI | InChI=1S/C8H12N5O6P/c9-6-5-7(11-2-10-5)13-8(12-6)18-1-4(14)19-3-20(15,16)17/h2,4,14H,1,3H2,(H2,15,16,17)(H3,9,10,11,12,13)/p+1 |
| InChIKey | VHNRQWTWMBPQJH-UHFFFAOYSA-O |
| XLogP | -1.80 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|