C8H12N5O2+ — CID 123348046
2-(2-methoxyethoxy)-7H-purin-9-ium-6-amine (PubChem CID 123348046) has the molecular formula C8H12N5O2+ and a molecular weight of 210.22 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-7H-purin-9-ium-6-amine.
| Compound Name | 2-(2-methoxyethoxy)-7H-purin-9-ium-6-amine |
|---|---|
| PubChem CID | 123348046 |
| Molecular Formula | C8H12N5O2+ |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(2-methoxyethoxy)-7H-purin-9-ium-6-amine |
| SMILES | COCCOc1nc(N)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C8H11N5O2/c1-14-2-3-15-8-12-6(9)5-7(13-8)11-4-10-5/h4H,2-3H2,1H3,(H3,9,10,11,12,13)/p+1 |
| InChIKey | IBZRWAWJSFLALK-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|