C9H12Cl2N2O — CID 118940482
2-butoxy-4,6-dichloro-5-methylpyrimidine (PubChem CID 118940482) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is 2-butoxy-4,6-dichloro-5-methylpyrimidine.
| Compound Name | 2-butoxy-4,6-dichloro-5-methylpyrimidine |
|---|---|
| PubChem CID | 118940482 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-butoxy-4,6-dichloro-5-methylpyrimidine |
| SMILES | CCCCOc1nc(Cl)c(C)c(Cl)n1 |
| InChI | InChI=1S/C9H12Cl2N2O/c1-3-4-5-14-9-12-7(10)6(2)8(11)13-9/h3-5H2,1-2H3 |
| InChIKey | UJYHVHDNFZKVHF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|