C16H19ClN2O — CID 82168908
2-(4-butoxyphenyl)-4-chloro-5,6-dimethylpyrimidine (PubChem CID 82168908) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-chloro-5,6-dimethylpyrimidine.
| Compound Name | 2-(4-butoxyphenyl)-4-chloro-5,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 82168908 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-chloro-5,6-dimethylpyrimidine |
| SMILES | CCCCOc1ccc(-c2nc(C)c(C)c(Cl)n2)cc1 |
| InChI | InChI=1S/C16H19ClN2O/c1-4-5-10-20-14-8-6-13(7-9-14)16-18-12(3)11(2)15(17)19-16/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | SYUOCBOPNMUUQH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|