C12H10Cl2N2 — CID 60996954
4-chloro-2-(4-chlorophenyl)-5,6-dimethylpyrimidine (PubChem CID 60996954) has the molecular formula C12H10Cl2N2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 4-chloro-2-(4-chlorophenyl)-5,6-dimethylpyrimidine.
| Compound Name | 4-chloro-2-(4-chlorophenyl)-5,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 60996954 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-chloro-2-(4-chlorophenyl)-5,6-dimethylpyrimidine |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)nc(Cl)c1C |
| InChI | InChI=1S/C12H10Cl2N2/c1-7-8(2)15-12(16-11(7)14)9-3-5-10(13)6-4-9/h3-6H,1-2H3 |
| InChIKey | SIHJBPGSYWHWGP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |