C17H30IN3O3 — CID 156523376
2-butoxy-4-(3-iodobutoxy)-6-(4-methylpentoxy)-1,3,5-triazine (PubChem CID 156523376) has the molecular formula C17H30IN3O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-butoxy-4-(3-iodobutoxy)-6-(4-methylpentoxy)-1,3,5-triazine.
| Compound Name | 2-butoxy-4-(3-iodobutoxy)-6-(4-methylpentoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 156523376 |
| Molecular Formula | C17H30IN3O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-butoxy-4-(3-iodobutoxy)-6-(4-methylpentoxy)-1,3,5-triazine |
| SMILES | CCCCOc1nc(OCCCC(C)C)nc(OCCC(C)I)n1 |
| InChI | InChI=1S/C17H30IN3O3/c1-5-6-10-22-15-19-16(23-11-7-8-13(2)3)21-17(20-15)24-12-9-14(4)18/h13-14H,5-12H2,1-4H3 |
| InChIKey | BPQMBMOMMHCMRG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|