C7H13N5O2 — CID 22501480
4-butoxy-1-hydroxy-6-imino-1,3,5-triazin-2-amine (PubChem CID 22501480) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-butoxy-1-hydroxy-6-imino-1,3,5-triazin-2-amine.
| Compound Name | 4-butoxy-1-hydroxy-6-imino-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 22501480 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-butoxy-1-hydroxy-6-imino-1,3,5-triazin-2-amine |
| SMILES | [H]/N=c1\nc(OCCCC)nc(N)n1O |
| InChI | InChI=1S/C7H13N5O2/c1-2-3-4-14-7-10-5(8)12(13)6(9)11-7/h13H,2-4H2,1H3,(H3,8,9,10,11) |
| InChIKey | QAVOCILYFZJCAH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|