C19H31N7O3 — CID 174341845
2-butoxy-4,6-bis[3-(1,2-dihydroimidazol-3-yl)propoxy]-1,3,5-triazine (PubChem CID 174341845) has the molecular formula C19H31N7O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-butoxy-4,6-bis[3-(1,2-dihydroimidazol-3-yl)propoxy]-1,3,5-triazine.
| Compound Name | 2-butoxy-4,6-bis[3-(1,2-dihydroimidazol-3-yl)propoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 174341845 |
| Molecular Formula | C19H31N7O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-butoxy-4,6-bis[3-(1,2-dihydroimidazol-3-yl)propoxy]-1,3,5-triazine |
| SMILES | CCCCOc1nc(OCCCN2C=CNC2)nc(OCCCN2C=CNC2)n1 |
| InChI | InChI=1S/C19H31N7O3/c1-2-3-12-27-17-22-18(28-13-4-8-25-10-6-20-15-25)24-19(23-17)29-14-5-9-26-11-7-21-16-26/h6-7,10-11,20-21H,2-5,8-9,12-16H2,1H3 |
| InChIKey | XHPCLHPHRTUEHU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|