C7H12N4S — CID 123312325
5-(5-iminopentyl)-1,3,4-thiadiazol-2-amine (PubChem CID 123312325) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 5-(5-iminopentyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(5-iminopentyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 123312325 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-(5-iminopentyl)-1,3,4-thiadiazol-2-amine |
| SMILES | [H]/N=C/CCCCc1nnc(N)s1 |
| InChI | InChI=1S/C7H12N4S/c8-5-3-1-2-4-6-10-11-7(9)12-6/h5,8H,1-4H2,(H2,9,11)/b8-5+ |
| InChIKey | CVRGPTFIUJDFOW-VMPITWQZSA-N |
| XLogP | 1.48 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|