C7H12N2S2 — CID 59817036
2-ethylsulfanyl-5-propyl-1,3,4-thiadiazole (PubChem CID 59817036) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-propyl-1,3,4-thiadiazole.
| Compound Name | 2-ethylsulfanyl-5-propyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 59817036 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-ethylsulfanyl-5-propyl-1,3,4-thiadiazole |
| SMILES | CCCc1nnc(SCC)s1 |
| InChI | InChI=1S/C7H12N2S2/c1-3-5-6-8-9-7(11-6)10-4-2/h3-5H2,1-2H3 |
| InChIKey | UKFKQWBGAQCXAZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |