C5H7ClN2S2 — CID 58430407
2-(chloromethylsulfanyl)-5-ethyl-1,3,4-thiadiazole (PubChem CID 58430407) has the molecular formula C5H7ClN2S2 and a molecular weight of 194.71 g/mol. Its IUPAC name is 2-(chloromethylsulfanyl)-5-ethyl-1,3,4-thiadiazole.
| Compound Name | 2-(chloromethylsulfanyl)-5-ethyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58430407 |
| Molecular Formula | C5H7ClN2S2 |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 2-(chloromethylsulfanyl)-5-ethyl-1,3,4-thiadiazole |
| SMILES | CCc1nnc(SCCl)s1 |
| InChI | InChI=1S/C5H7ClN2S2/c1-2-4-7-8-5(10-4)9-3-6/h2-3H2,1H3 |
| InChIKey | MUEKJVFASKDGNX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|