C6H11N3OS — CID 131224371
1-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-methoxymethanamine (PubChem CID 131224371) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-methoxymethanamine.
| Compound Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 131224371 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-N-methoxymethanamine |
| SMILES | CCc1nnc(CNOC)s1 |
| InChI | InChI=1S/C6H11N3OS/c1-3-5-8-9-6(11-5)4-7-10-2/h7H,3-4H2,1-2H3 |
| InChIKey | VDRLUHSNNXQFMV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|