C5H7N3OS — CID 3846618
N-(5-ethyl-1,3,4-thiadiazol-2-yl)formamide (PubChem CID 3846618) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)formamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)formamide |
|---|---|
| PubChem CID | 3846618 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)formamide |
| SMILES | CCc1nnc(NC=O)s1 |
| InChI | InChI=1S/C5H7N3OS/c1-2-4-7-8-5(10-4)6-3-9/h3H,2H2,1H3,(H,6,8,9) |
| InChIKey | ZBPWCZPAIFSXRU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|