C7H11N3S — CID 554185
5-ethyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 554185) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-ethyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-ethyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 554185 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-ethyl-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(CC)s1 |
| InChI | InChI=1S/C7H11N3S/c1-3-5-8-7-10-9-6(4-2)11-7/h3H,1,4-5H2,2H3,(H,8,10) |
| InChIKey | VAOSCSDQXFNERR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|