C6H9N3OS — CID 21239238
N-(5-propyl-1,3,4-thiadiazol-2-yl)formamide (PubChem CID 21239238) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is N-(5-propyl-1,3,4-thiadiazol-2-yl)formamide.
| Compound Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)formamide |
|---|---|
| PubChem CID | 21239238 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)formamide |
| SMILES | CCCc1nnc(NC=O)s1 |
| InChI | InChI=1S/C6H9N3OS/c1-2-3-5-8-9-6(11-5)7-4-10/h4H,2-3H2,1H3,(H,7,9,10) |
| InChIKey | RAESBMHFYOFFHZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|