C10H17N3O2S — CID 82316839
ethyl 3-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]propanoate (PubChem CID 82316839) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is ethyl 3-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]propanoate.
| Compound Name | ethyl 3-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 82316839 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | ethyl 3-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]propanoate |
| SMILES | CCCc1nnc(NCCC(=O)OCC)s1 |
| InChI | InChI=1S/C10H17N3O2S/c1-3-5-8-12-13-10(16-8)11-7-6-9(14)15-4-2/h3-7H2,1-2H3,(H,11,13) |
| InChIKey | JXYVGWLMNIRGSQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |