C16H20N2O2S — CID 82316835
ethyl 3-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]propanoate (PubChem CID 82316835) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 3-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 82316835 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 3-[[4-(4-ethylphenyl)-1,3-thiazol-2-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1nc(-c2ccc(CC)cc2)cs1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-12-5-7-13(8-6-12)14-11-21-16(18-14)17-10-9-15(19)20-4-2/h5-8,11H,3-4,9-10H2,1-2H3,(H,17,18) |
| InChIKey | JIPKMCGOOREMHS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |